1,3(2H,4H)-Isoquinolinedione,5,6,7,8-tetrahydro-4-(phenylmethylene)-
Modify Date: 2025-08-26 15:51:05
1,3(2H,4H)-Isoquinolinedione,5,6,7,8-tetrahydro-4-(phenylmethylene)- structure
|
Common Name | 1,3(2H,4H)-Isoquinolinedione,5,6,7,8-tetrahydro-4-(phenylmethylene)- | ||
|---|---|---|---|---|
| CAS Number | 35423-09-7 | Molecular Weight | 253.29600 | |
| Density | 1.23g/cm3 | Boiling Point | 466ºC at 760mmHg | |
| Molecular Formula | C16H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.7ºC | |
| Name | (4Z)-4-benzylidene-5,6,7,8-tetrahydroisoquinoline-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 466ºC at 760mmHg |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.29600 |
| Flash Point | 186.7ºC |
| Exact Mass | 253.11000 |
| PSA | 46.17000 |
| LogP | 2.92580 |
| Index of Refraction | 1.621 |
| InChIKey | JFTOCKFCHJCDDX-UVTDQMKNSA-N |
| SMILES | O=C1NC(=O)C2=C(CCCC2)C1=Cc1ccccc1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| UNII-WHO633E898 |
| Tesimide |
| Tesimide (USAN/INN) |