2,4-Dinitrobenzenesulfonyl fluoride
Modify Date: 2025-08-26 12:14:13
2,4-Dinitrobenzenesulfonyl fluoride structure
|
Common Name | 2,4-Dinitrobenzenesulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 35426-71-2 | Molecular Weight | 250.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H3FN2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-Dinitrobenzenesulfonyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H3FN2O6S |
|---|---|
| Molecular Weight | 250.16 |
| InChIKey | AUPURNORNBGWKI-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)F)c([N+](=O)[O-])c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 35426-71-2? |
| A: Chinese name of 35426-71-2 is 35426-71-2. |
| Q: What is the SMILES notation of 2,4-Dinitrobenzenesulfonyl fluoride? |
| A: SMILES notation of 2,4-Dinitrobenzenesulfonyl fluoride is O=[N+]([O-])c1ccc(S(=O)(=O)F)c([N+](=O)[O-])c1. |
| Q: What is the English name of 2,4-Dinitrobenzenesulfonyl fluoride? |
| A: The English name of 2,4-Dinitrobenzenesulfonyl fluoride is 2,4-Dinitrobenzenesulfonyl fluoride. |
| Q: What is the CAS number of 2,4-Dinitrobenzenesulfonyl fluoride? |
| A: CAS number of 2,4-Dinitrobenzenesulfonyl fluoride is 35426-71-2. |
| Q: What is the molecular weight of 2,4-Dinitrobenzenesulfonyl fluoride? |
| A: Molecular weight of 2,4-Dinitrobenzenesulfonyl fluoride is 250.16. |
| Q: What is the InChIKey of 2,4-Dinitrobenzenesulfonyl fluoride? |
| A: InChIKey of 2,4-Dinitrobenzenesulfonyl fluoride is AUPURNORNBGWKI-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,4-Dinitrobenzenesulfonyl fluoride? |
| A: Molecular formula of 2,4-Dinitrobenzenesulfonyl fluoride is C6H3FN2O6S. |