2-Ethyl-2-methylheptaneperoxoic acid tert-butyl ester structure
|
Common Name | 2-Ethyl-2-methylheptaneperoxoic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 35432-78-1 | Molecular Weight | 244.37000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H28O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl 2-ethyl-2-methylheptaneperoxoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H28O3 |
|---|---|
| Molecular Weight | 244.37000 |
| Exact Mass | 244.20400 |
| PSA | 35.53000 |
| LogP | 4.25630 |
| InChIKey | KHJNXCATZZIGAX-UHFFFAOYSA-N |
| SMILES | CCCCCC(C)(CC)C(=O)OOC(C)(C)C |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Heptaneperoxoic acid,2-ethyl-2-methyl-,1,1-dimethylethyl ester |
| tert-Butyl-perneodecanoat |