Bis-(trimethylstannyl)-propane structure
|
Common Name | Bis-(trimethylstannyl)-propane | ||
|---|---|---|---|---|
| CAS Number | 35434-81-2 | Molecular Weight | 369.68900 | |
| Density | N/A | Boiling Point | 257.3ºC at 760mmHg | |
| Molecular Formula | C9H24Sn2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 111.4ºC | |
| Name | trimethyl(3-trimethylstannylpropyl)stannane |
|---|
| Boiling Point | 257.3ºC at 760mmHg |
|---|---|
| Molecular Formula | C9H24Sn2 |
| Molecular Weight | 369.68900 |
| Flash Point | 111.4ºC |
| Exact Mass | 371.99200 |
| LogP | 2.98490 |
| InChIKey | JIVXOVKFQCJKAK-UHFFFAOYSA-N |
| SMILES | C[Sn](C)(C)CCC[Sn](C)(C)C |
| HS Code | 2931900090 |
|---|
|
~%
Bis-(trimethyls... CAS#:35434-81-2 |
| Literature: Jurkschat, Klaus; Kuivila, Henry; Liu, Shuncheng; Zubieta, Jon A. Organometallics, 1989 , vol. 8, p. 2755 - 2759 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |