3-Methoxy-5-nitrobenzaldehyde structure
|
Common Name | 3-Methoxy-5-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 354512-22-4 | Molecular Weight | 181.145 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 326.5±27.0 °C at 760 mmHg | |
| Molecular Formula | C8H7NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.4±25.7 °C | |
| Name | 3-methoxy-5-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 326.5±27.0 °C at 760 mmHg |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.145 |
| Flash Point | 165.4±25.7 °C |
| Exact Mass | 181.037506 |
| PSA | 72.12000 |
| LogP | 2.06 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.590 |
| InChIKey | XZFQLZGPDRXXHV-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)cc([N+](=O)[O-])c1 |
| HS Code | 2913000090 |
|---|
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 3-Methoxy-5-nitrobenzaldehyde |
| Benzaldehyde, 3-methoxy-5-nitro- |
| Benzaldehyde,3-methoxy-5-nitro |