3-Methoxy-5-nitrobenzaldehyde
3-Methoxy-5-nitrobenzaldehyde structure
|
Common Name | 3-Methoxy-5-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 354512-22-4 | Molecular Weight | 181.145 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 326.5±27.0 °C at 760 mmHg | |
| Molecular Formula | C8H7NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.4±25.7 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-methoxy-5-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 326.5±27.0 °C at 760 mmHg |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.145 |
| Flash Point | 165.4±25.7 °C |
| Exact Mass | 181.037506 |
| PSA | 72.12000 |
| LogP | 2.06 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.590 |
| InChIKey | XZFQLZGPDRXXHV-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)cc([N+](=O)[O-])c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2913000090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Methoxy-5-nitrobenzaldehyde |
| Benzaldehyde,3-methoxy-5-nitro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-methoxy-5-nitrobenzaldehyde? |
| A: Molecular weight of 3-methoxy-5-nitrobenzaldehyde is 181.145. |
| Q: What English synonyms does 3-methoxy-5-nitrobenzaldehyde have? |
| A: English synonyms of 3-methoxy-5-nitrobenzaldehyde: 3-Methoxy-5-nitrobenzaldehyde, Benzaldehyde,3-methoxy-5-nitro. |
| Q: What is the English name of 3-methoxy-5-nitrobenzaldehyde? |
| A: The English name of 3-methoxy-5-nitrobenzaldehyde is 3-methoxy-5-nitrobenzaldehyde. |
| Q: What is the LogP of 3-methoxy-5-nitrobenzaldehyde? |
| A: LogP of 3-methoxy-5-nitrobenzaldehyde is 2.06. |
| Q: What is the SMILES notation of 3-methoxy-5-nitrobenzaldehyde? |
| A: SMILES notation of 3-methoxy-5-nitrobenzaldehyde is COc1cc(C=O)cc([N+](=O)[O-])c1. |
| Q: What is the molecular formula of 3-methoxy-5-nitrobenzaldehyde? |
| A: Molecular formula of 3-methoxy-5-nitrobenzaldehyde is C8H7NO4. |
| Q: What is the polar surface area (PSA) of 3-methoxy-5-nitrobenzaldehyde? |
| A: Polar surface area (PSA) of 3-methoxy-5-nitrobenzaldehyde is 72.12000. |
| Q: What is the boiling point of 3-methoxy-5-nitrobenzaldehyde? |
| A: Boiling point of 3-methoxy-5-nitrobenzaldehyde is 326.5±27.0 °C at 760 mmHg. |
| Q: What is the InChIKey of 3-methoxy-5-nitrobenzaldehyde? |
| A: InChIKey of 3-methoxy-5-nitrobenzaldehyde is XZFQLZGPDRXXHV-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-methoxy-5-nitrobenzaldehyde? |
| A: CAS number of 3-methoxy-5-nitrobenzaldehyde is 354512-22-4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |