8-benzylidene-6,10-dioxaspiro[4.5]decane-7,9-dione structure
|
Common Name | 8-benzylidene-6,10-dioxaspiro[4.5]decane-7,9-dione | ||
|---|---|---|---|---|
| CAS Number | 354532-21-1 | Molecular Weight | 258.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-benzylidene-6,10-dioxaspiro[4.5]decane-7,9-dione |
|---|
| Molecular Formula | C15H14O4 |
|---|---|
| Molecular Weight | 258.26900 |
| Exact Mass | 258.08900 |
| PSA | 52.60000 |
| LogP | 2.44030 |
| InChIKey | WVXJFVYGNVTBLN-UHFFFAOYSA-N |
| SMILES | O=C1OC2(CCCC2)OC(=O)C1=Cc1ccccc1 |
|
~%
8-benzylidene-6... CAS#:354532-21-1 |
| Literature: Medien; Zahran; Erian Journal of the Chinese Chemical Society, 2004 , vol. 51, # 1 p. 139 - 145 |
|
~%
8-benzylidene-6... CAS#:354532-21-1 |
| Literature: Medien; Zahran; Erian Journal of the Chinese Chemical Society, 2004 , vol. 51, # 1 p. 139 - 145 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |