4,6-ditert-butyl-2-[(3,5-ditert-butyl-2,6-dihydroxyphenyl)methyl]benzene-1,3-diol structure
|
Common Name | 4,6-ditert-butyl-2-[(3,5-ditert-butyl-2,6-dihydroxyphenyl)methyl]benzene-1,3-diol | ||
|---|---|---|---|---|
| CAS Number | 35455-61-9 | Molecular Weight | 456.65700 | |
| Density | 1.063g/cm3 | Boiling Point | 566.5ºC at 760 mmHg | |
| Molecular Formula | C29H44O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.6ºC | |
| Name | 4,6-ditert-butyl-2-[(3,5-ditert-butyl-2,6-dihydroxyphenyl)methyl]benzene-1,3-diol |
|---|
| Density | 1.063g/cm3 |
|---|---|
| Boiling Point | 566.5ºC at 760 mmHg |
| Molecular Formula | C29H44O4 |
| Molecular Weight | 456.65700 |
| Flash Point | 231.6ºC |
| Exact Mass | 456.32400 |
| PSA | 80.92000 |
| LogP | 7.28980 |
| Index of Refraction | 1.549 |
| InChIKey | BDENIXXGMSURKB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(O)c(Cc2c(O)c(C(C)(C)C)cc(C(C)(C)C)c2O)c1O |
| HS Code | 2907299090 |
|---|
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |