[2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid
![[2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid Structure](https://image.chemsrc.com/caspic/325/354574-30-4.png)
[2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid structure
|
Common Name | [2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 354574-30-4 | Molecular Weight | 281.30400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: [2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid (CAS: 354574-30-4), molecular formula: C14H19NO5, molecular weight: 281.30400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H19NO5 |
|---|---|
| Molecular Weight | 281.30400 |
| Exact Mass | 281.12600 |
| PSA | 84.86000 |
| LogP | 2.74230 |
| InChIKey | ZUUWNMRRGBGYKJ-UHFFFAOYSA-N |
| SMILES | COc1cccc(CC(=O)O)c1NC(=O)OC(C)(C)C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2924299090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of [2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid? |
| A: The English name of [2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid is [2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid. |
| Q: What is the molecular weight of [2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid? |
| A: Molecular weight of [2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid is 281.30400. |
| Q: What is the molecular formula of [2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid? |
| A: Molecular formula of [2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid is C14H19NO5. |
| Q: What is the InChIKey of [2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid? |
| A: InChIKey of [2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid is ZUUWNMRRGBGYKJ-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of [2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid? |
| A: Polar surface area (PSA) of [2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid is 84.86000. |
| Q: What is the SMILES notation of [2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid? |
| A: SMILES notation of [2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid is COc1cccc(CC(=O)O)c1NC(=O)OC(C)(C)C. |
| Q: What is the CAS number of [2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid? |
| A: CAS number of [2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid is 354574-30-4. |
| Q: What is the LogP of [2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid? |
| A: LogP of [2-[(tert-butoxycarbonyl)amino]-3-methoxyphenyl]acetic acid is 2.74230. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |