4-(5-Formyl-thiazol-2-yl)-piperazine-1-carboxylic acid tert-butyl ester structure
|
Common Name | 4-(5-Formyl-thiazol-2-yl)-piperazine-1-carboxylic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 354587-77-2 | Molecular Weight | 297.37300 | |
| Density | 1.269g/cm3 | Boiling Point | 437.7ºC at 760 mmHg | |
| Molecular Formula | C13H19N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.5ºC | |
| Name | tert-butyl 4-(5-formyl-1,3-thiazol-2-yl)piperazine-1-carboxylate |
|---|
| Density | 1.269g/cm3 |
|---|---|
| Boiling Point | 437.7ºC at 760 mmHg |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.37300 |
| Flash Point | 218.5ºC |
| Exact Mass | 297.11500 |
| PSA | 90.98000 |
| LogP | 2.01560 |
| Index of Refraction | 1.58 |
| InChIKey | JUVLYFQRUBLHEH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ncc(C=O)s2)CC1 |
| HS Code | 2934100090 |
|---|
|
~39%
4-(5-Formyl-thi... CAS#:354587-77-2 |
| Literature: F. HOFFMANN-LA ROCHE AG Patent: WO2006/72436 A1, 2006 ; Location in patent: Page/Page column 71 ; |
|
~89%
4-(5-Formyl-thi... CAS#:354587-77-2 |
| Literature: Anandan, Sampath-Kumar; Ward, John S.; Brokx, Richard D.; Denny, Trisha; Bray, Mark R.; Patel, Dinesh V.; Xiao, Xiao-Yi Bioorganic and Medicinal Chemistry Letters, 2007 , vol. 17, # 21 p. 5995 - 5999 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |