4-methoxy-2-[(E)-2-nitroethenyl]phenol structure
|
Common Name | 4-methoxy-2-[(E)-2-nitroethenyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 35467-98-2 | Molecular Weight | 195.17200 | |
| Density | 1.308g/cm3 | Boiling Point | 376.9ºC at 760 mmHg | |
| Molecular Formula | C9H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.7ºC | |
| Name | 2-HYDROXY-5-METHOXY-β-NITROSTYRENE |
|---|
| Density | 1.308g/cm3 |
|---|---|
| Boiling Point | 376.9ºC at 760 mmHg |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17200 |
| Flash Point | 181.7ºC |
| Exact Mass | 195.05300 |
| PSA | 75.28000 |
| LogP | 2.17140 |
| Index of Refraction | 1.615 |
| InChIKey | XHZXDCADXNMUGF-SNAWJCMRSA-N |
| SMILES | COc1ccc(O)c(C=C[N+](=O)[O-])c1 |
| HS Code | 2909500000 |
|---|
|
~37%
4-methoxy-2-[(E... CAS#:35467-98-2 |
| Literature: Ramachary, Dhevalapally B.; Sakthidevi, Rajasekar Organic and Biomolecular Chemistry, 2010 , vol. 8, # 19 p. 4259 - 4265 |
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |