ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate
ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate structure
|
Common Name | ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 35482-84-9 | Molecular Weight | 264.36000 | |
| Density | 1.06g/cm3 | Boiling Point | 364.2ºC at 760 mmHg | |
| Molecular Formula | C16H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.7ºC | |
Summary: ethyl 4a,7,7- trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate, Chinese name not provided, CAS number 35482-84-9, molecular formula C16H24O3, molecular weight 264.36000, density 1.06g/cm3, boiling point 364.2ºC. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 364.2ºC at 760 mmHg |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36000 |
| Flash Point | 157.7ºC |
| Exact Mass | 264.17300 |
| PSA | 43.37000 |
| LogP | 3.42540 |
| Index of Refraction | 1.502 |
| InChIKey | DFOMFGLTELLGGG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2CC(C)(C)CCC2(C)CCC1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ethyl 4a,7,7-tr... CAS#:35482-84-9 |
| Literature: Ellis,J.E. et al. Synthetic Communications, 1974 , vol. 4, p. 71 - 77 |
|
~%
ethyl 4a,7,7-tr... CAS#:35482-84-9 |
| Literature: Ellis,J.E. et al. Synthetic Communications, 1974 , vol. 4, p. 71 - 77 |
|
~%
ethyl 4a,7,7-tr... CAS#:35482-84-9 |
| Literature: Koenst,W.M.B. et al. Tetrahedron, 1976 , vol. 32, p. 1415 - 1421 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate? |
| A: The English name of ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate is ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate. |
| Q: What is the molecular formula of ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate? |
| A: Molecular formula of ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate is C16H24O3. |
| Q: What is the LogP of ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate? |
| A: LogP of ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate is 3.42540. |
| Q: What is the Chinese name of 35482-84-9? |
| A: Chinese name of 35482-84-9 is 35482-84-9. |
| Q: What are the upstream materials of ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate? |
| A: Related upstream materials(CAS) of ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate: 49775-37-3;33543-18-9;22418-80-0. |
| Q: What is the boiling point of ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate? |
| A: Boiling point of ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate is 364.2ºC at 760 mmHg. |
| Q: What is the SMILES notation of ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate? |
| A: SMILES notation of ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate is CCOC(=O)C1=C2CC(C)(C)CCC2(C)CCC1=O. |
| Q: What is the InChIKey of ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate? |
| A: InChIKey of ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate is DFOMFGLTELLGGG-UHFFFAOYSA-N. |
| Q: What is the molecular weight of ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate? |
| A: Molecular weight of ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate is 264.36000. |
| Q: What is the CAS number of ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate? |
| A: CAS number of ethyl 4a,7,7-trimethyl-2-oxo-4,5,6,8-tetrahydro-3H-naphthalene-1-carboxylate is 35482-84-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |