2-Chloro-5-nitro-4'-methylbenzophenone structure
|
Common Name | 2-Chloro-5-nitro-4'-methylbenzophenone | ||
|---|---|---|---|---|
| CAS Number | 35485-71-3 | Molecular Weight | 275.68700 | |
| Density | 1.327g/cm3 | Boiling Point | 436.2ºC at 760 mmHg | |
| Molecular Formula | C14H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.6ºC | |
| Name | 2-Chloro-5-nitro-4'-methylbenzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.327g/cm3 |
|---|---|
| Boiling Point | 436.2ºC at 760 mmHg |
| Molecular Formula | C14H10ClNO3 |
| Molecular Weight | 275.68700 |
| Flash Point | 217.6ºC |
| Exact Mass | 275.03500 |
| PSA | 62.89000 |
| LogP | 4.31080 |
| Index of Refraction | 1.613 |
| InChIKey | YAHRMDKLABSJKX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)c2cc([N+](=O)[O-])ccc2Cl)cc1 |
|
~%
2-Chloro-5-nitr... CAS#:35485-71-3 |
| Literature: Bellamy; Chazan; Dodey; Dutartre; Ou; Pascal; Robin Journal of Medicinal Chemistry, 1991 , vol. 34, # 5 p. 1545 - 1552 |
|
~%
2-Chloro-5-nitr... CAS#:35485-71-3 |
| Literature: Bellamy; Chazan; Dodey; Dutartre; Ou; Pascal; Robin Journal of Medicinal Chemistry, 1991 , vol. 34, # 5 p. 1545 - 1552 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-chloro-4'-methyl-5-nitro-benzophenone |