bis(2-methoxy-5-methyl-phenyl)diazene structure
|
Common Name | bis(2-methoxy-5-methyl-phenyl)diazene | ||
|---|---|---|---|---|
| CAS Number | 35485-95-1 | Molecular Weight | 270.32600 | |
| Density | 1.07g/cm3 | Boiling Point | 424.8ºC at 760 mmHg | |
| Molecular Formula | C16H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.8ºC | |
| Name | bis(2-methoxy-5-methylphenyl)diazene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 424.8ºC at 760 mmHg |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.32600 |
| Flash Point | 169.8ºC |
| Exact Mass | 270.13700 |
| PSA | 43.18000 |
| LogP | 4.73600 |
| Index of Refraction | 1.541 |
| InChIKey | HEFPYMFLAXYNMB-UHFFFAOYSA-N |
| SMILES | COc1ccc(C)cc1N=Nc1cc(C)ccc1OC |
|
~%
bis(2-methoxy-5... CAS#:35485-95-1 |
| Literature: Adams; Kornblum Journal of the American Chemical Society, 1941 , vol. 63, p. 188,196 |
|
~%
bis(2-methoxy-5... CAS#:35485-95-1 |
| Literature: Brasch; Freyss Chemische Berichte, 1891 , vol. 24, p. 1963,1964 |
|
~%
bis(2-methoxy-5... CAS#:35485-95-1 |
| Literature: Brasch; Freyss Chemische Berichte, 1891 , vol. 24, p. 1963,1964 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6.6'-Dimethoxy-3.3'-dimethyl-azobenzol |