undecafluorocyclohexanesulphonyl fluoride structure
|
Common Name | undecafluorocyclohexanesulphonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 355-03-3 | Molecular Weight | 364.10900 | |
| Density | 1.88g/cm3 | Boiling Point | 182.3ºC at 760mmHg | |
| Molecular Formula | C6F12O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 64.1ºC | |
| Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-sulfonyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.88g/cm3 |
|---|---|
| Boiling Point | 182.3ºC at 760mmHg |
| Molecular Formula | C6F12O2S |
| Molecular Weight | 364.10900 |
| Flash Point | 64.1ºC |
| Exact Mass | 363.94300 |
| PSA | 42.52000 |
| LogP | 4.22240 |
| Index of Refraction | 1.317 |
| InChIKey | SUYQQGZHVVTMNY-UHFFFAOYSA-N |
| SMILES | O=S(=O)(F)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| HS Code | 2904909090 |
|---|
|
~39%
undecafluorocyc... CAS#:355-03-3 |
| Literature: Gmelin Handbook: F: PerFHalOrg.2, 1.3.4, page 137 - 166 |
|
~43%
undecafluorocyc... CAS#:355-03-3 |
| Literature: Gmelin Handbook: F: PerFHalOrg.2, 1.3.4, page 137 - 166 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Perfluorcyclohexansulfonsaeurefluorid |
| Undecafluorocyclohexanesulfonyl fluoride |
| Undecafluorocyclohexanesulphonyl fluoride |
| perflorocyclohexanesulfonylfluoride |
| Perfluorcyclohexansulfonylfluorid |
| EINECS 206-574-0 |
| Undecafluor-cyclohexansulfonylfluorid |
| Cyclohexanesulfonyl fluoride,undecafluoro |