1H,1H-Nonafluoropentylamine structure
|
Common Name | 1H,1H-Nonafluoropentylamine | ||
|---|---|---|---|---|
| CAS Number | 355-27-1 | Molecular Weight | 249.07800 | |
| Density | 1.519g/cm3 | Boiling Point | 89.8ºC at 760 mmHg | |
| Molecular Formula | C5H4F9N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 20ºC | |
| Name | 2,2,3,3,4,4,5,5,5-nonafluoropentan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.519g/cm3 |
|---|---|
| Boiling Point | 89.8ºC at 760 mmHg |
| Molecular Formula | C5H4F9N |
| Molecular Weight | 249.07800 |
| Flash Point | 20ºC |
| Exact Mass | 249.02000 |
| PSA | 26.02000 |
| LogP | 3.11360 |
| Index of Refraction | 1.293 |
| InChIKey | SUNUNYBGDFIAME-UHFFFAOYSA-N |
| SMILES | NCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2921199090 |
|---|
|
~%
1H,1H-Nonafluor... CAS#:355-27-1 |
| Literature: Soloshonok, Vadim A.; Catt, Hector T.; Ono, Taizo Journal of Fluorine Chemistry, 2010 , vol. 131, # 2 p. 261 - 265 |
| HS Code | 2921199090 |
|---|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1H,1H-NonafluoropentylaMine |
| 1H,1H-Nonafluoropentylamine |
| 2,2,3,3,4,4,5,5,5-nonafluorobutylamine |
| 2,2,3,3,4,4,5,5,5-nonafluoropentylamine |
| 1H,1H,-perfluoropentylamine |
| 1-Amino-1H,1H-nonafluor-pentan |
| 2,2,3,3,4,4,5,5,5-Nonafluor-pentylamin |