1-chloro-5H-decafluoro-pentane
1-chloro-5H-decafluoro-pentane structure
|
Common Name | 1-chloro-5H-decafluoro-pentane | ||
|---|---|---|---|---|
| CAS Number | 355-29-3 | Molecular Weight | 286.49800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5HClF10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-chloro-5H-decafluoro-pentane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5HClF10 |
|---|---|
| Molecular Weight | 286.49800 |
| Exact Mass | 285.96100 |
| LogP | 3.98900 |
| InChIKey | DXAPPFLFNMWPCB-UHFFFAOYSA-N |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:375-61-1
CAS#:507-68-6
CAS#:678-78-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Chlor-5H-decafluor-pentan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-chloro-5H-decafluoro-pentane? |
| A: Molecular formula of 1-chloro-5H-decafluoro-pentane is C5HClF10. |
| Q: What is the SMILES notation of 1-chloro-5H-decafluoro-pentane? |
| A: SMILES notation of 1-chloro-5H-decafluoro-pentane is FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl. |
| Q: What English synonyms does 1-chloro-5H-decafluoro-pentane have? |
| A: English synonyms of 1-chloro-5H-decafluoro-pentane: 1-Chlor-5H-decafluor-pentan. |
| Q: What is the English name of 1-chloro-5H-decafluoro-pentane? |
| A: The English name of 1-chloro-5H-decafluoro-pentane is 1-chloro-5H-decafluoro-pentane. |
| Q: What is the CAS number of 1-chloro-5H-decafluoro-pentane? |
| A: CAS number of 1-chloro-5H-decafluoro-pentane is 355-29-3. |
| Q: What is the molecular weight of 1-chloro-5H-decafluoro-pentane? |
| A: Molecular weight of 1-chloro-5H-decafluoro-pentane is 286.49800. |
| Q: What is the Chinese name of 355-29-3? |
| A: Chinese name of 355-29-3 is 355-29-3. |
| Q: What is the InChIKey of 1-chloro-5H-decafluoro-pentane? |
| A: InChIKey of 1-chloro-5H-decafluoro-pentane is DXAPPFLFNMWPCB-UHFFFAOYSA-N. |
| Q: What are the downstream products of 1-chloro-5H-decafluoro-pentane? |
| A: Related downstream products(CAS) of 1-chloro-5H-decafluoro-pentane: 375-61-1;507-68-6;678-78-4. |
| Q: What is the LogP of 1-chloro-5H-decafluoro-pentane? |
| A: LogP of 1-chloro-5H-decafluoro-pentane is 3.98900. |