1,1,1,2,2,3,3,4,4,5,5,6,7,7-tetradecafluoro-7-methoxyheptane structure
|
Common Name | 1,1,1,2,2,3,3,4,4,5,5,6,7,7-tetradecafluoro-7-methoxyheptane | ||
|---|---|---|---|---|
| CAS Number | 355-70-4 | Molecular Weight | 382.09400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4F14O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1,2,2,3,3,4,4,5,5,6,7,7-tetradecafluoro-7-methoxyheptane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H4F14O |
|---|---|
| Molecular Weight | 382.09400 |
| Exact Mass | 382.00400 |
| PSA | 9.23000 |
| LogP | 4.66720 |
| InChIKey | BWLMIRDPTUENLI-UHFFFAOYSA-N |
| SMILES | COC(F)(F)C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2909199090 |
|---|
|
~%
1,1,1,2,2,3,3,4... CAS#:355-70-4 |
| Literature: Shepard et al. Journal of Organic Chemistry, 1958 , vol. 23, p. 2011 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909199090 |
|---|---|
| Summary | 2909199090. other acyclic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1-Methoxy-2-hydro-fluorheptan |
| Heptane,1,1,1,2,2,3,3,4,4,5,5,6,7,7-tetradecafluoro-7-methoxy |