2,2,3,3,4,4,5,5-octafluorohexanedioic acid
Modify Date: 2025-10-01 10:46:59
2,2,3,3,4,4,5,5-octafluorohexanedioic acid structure
|
Common Name | 2,2,3,3,4,4,5,5-octafluorohexanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 355-71-5 | Molecular Weight | 313.05500 | |
| Density | 1.806g/cm3 | Boiling Point | 274.4ºC at 760mmHg | |
| Molecular Formula | C6H2F8NaO4+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 119.8ºC | |
| Name | sodium,2,2,3,3,4,4,5,5-octafluorohexanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.806g/cm3 |
|---|---|
| Boiling Point | 274.4ºC at 760mmHg |
| Molecular Formula | C6H2F8NaO4+ |
| Molecular Weight | 313.05500 |
| Flash Point | 119.8ºC |
| Exact Mass | 312.97200 |
| PSA | 74.60000 |
| LogP | 1.69680 |
| InChIKey | PSAFGJSFLLLVFY-UHFFFAOYSA-N |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)O.[Na+] |
|
~64%
2,2,3,3,4,4,5,5... CAS#:355-71-5 |
| Literature: Deacon, Glen B.; Elgersma, Winfried; Harika, Rita; Junk, Peter C.; Skelton, Brian W.; White, Allan H. Canadian Journal of Chemistry, 2009 , vol. 87, # 1 SPEC. ISS. p. 121 - 133 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:377-36-6|
Name: Assays to identify small molecules inhibitory for eIF4E expression
Source: 13133
Target: N/A
External Id: 20160513eIF4E
|
Total 1, Current Page 1 of 1
1
| perfluoroadipic acid disodium salt |
| Dibenzofuran,octafluoro |
| octafluoro-hexanedioic acid,disodium salt |
| Octafluordibenzofuran |
| octafluoro-dibenzofuran |