Pentanedioic acid, 2,2,3,3,4,4-hexafluoro-, silver(1+) salt(1:2)
Pentanedioic acid, 2,2,3,3,4,4-hexafluoro-, silver(1+) salt(1:2) structure
|
Common Name | Pentanedioic acid, 2,2,3,3,4,4-hexafluoro-, silver(1+) salt(1:2) | ||
|---|---|---|---|---|
| CAS Number | 355-85-1 | Molecular Weight | 347.92600 | |
| Density | 1.802g/cm3 | Boiling Point | 289.6ºC at 760mmHg | |
| Molecular Formula | C5H2AgF6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 104.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2,3,3,4,4-hexafluoropentanedioic acid,silver |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.802g/cm3 |
|---|---|
| Boiling Point | 289.6ºC at 760mmHg |
| Molecular Formula | C5H2AgF6O4 |
| Molecular Weight | 347.92600 |
| Flash Point | 104.6ºC |
| Exact Mass | 346.89100 |
| PSA | 74.60000 |
| LogP | 1.06150 |
| InChIKey | XTQLFBAXQJISDS-UHFFFAOYSA-N |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(=O)O.[Ag] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 4 | |
CAS#:4259-29-4
CAS#:662-01-1
CAS#:5930-66-5
CAS#:7440-22-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| disilver hexafluoroglutarate |
| Hexafluor-glutarsaeure,Disilber-Salz |
| Disilber-perfluorglutarat |
| Hexafluordisiloxan |
| hexafluoro-glutaric acid,disilver-salt |
| Hexafluorodisiloxane |
| Disiloxane,1,1,1,3,3,3-hexafluoro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,2,3,3,4,4-hexafluoropentanedioic acid,silver? |
| A: CAS number of 2,2,3,3,4,4-hexafluoropentanedioic acid,silver is 355-85-1. |
| Q: What is the molecular weight of 2,2,3,3,4,4-hexafluoropentanedioic acid,silver? |
| A: Molecular weight of 2,2,3,3,4,4-hexafluoropentanedioic acid,silver is 347.92600. |
| Q: What is the InChIKey of 2,2,3,3,4,4-hexafluoropentanedioic acid,silver? |
| A: InChIKey of 2,2,3,3,4,4-hexafluoropentanedioic acid,silver is XTQLFBAXQJISDS-UHFFFAOYSA-N. |
| Q: What English synonyms does 2,2,3,3,4,4-hexafluoropentanedioic acid,silver have? |
| A: English synonyms of 2,2,3,3,4,4-hexafluoropentanedioic acid,silver: disilver hexafluoroglutarate, Hexafluor-glutarsaeure,Disilber-Salz, Disilber-perfluorglutarat, Hexafluordisiloxan, hexafluoro-glutaric acid,disilver-salt, Hexafluorodisiloxane, Disiloxane,1,1,1,3,3,3-hexafluoro. |
| Q: What is the Chinese name of 355-85-1? |
| A: Chinese name of 355-85-1 is 355-85-1. |
| Q: What is the SMILES notation of 2,2,3,3,4,4-hexafluoropentanedioic acid,silver? |
| A: SMILES notation of 2,2,3,3,4,4-hexafluoropentanedioic acid,silver is O=C(O)C(F)(F)C(F)(F)C(F)(F)C(=O)O.[Ag]. |
| Q: What is the molecular formula of 2,2,3,3,4,4-hexafluoropentanedioic acid,silver? |
| A: Molecular formula of 2,2,3,3,4,4-hexafluoropentanedioic acid,silver is C5H2AgF6O4. |
| Q: What is the polar surface area (PSA) of 2,2,3,3,4,4-hexafluoropentanedioic acid,silver? |
| A: Polar surface area (PSA) of 2,2,3,3,4,4-hexafluoropentanedioic acid,silver is 74.60000. |
| Q: What is the LogP of 2,2,3,3,4,4-hexafluoropentanedioic acid,silver? |
| A: LogP of 2,2,3,3,4,4-hexafluoropentanedioic acid,silver is 1.06150. |
| Q: What is the boiling point of 2,2,3,3,4,4-hexafluoropentanedioic acid,silver? |
| A: Boiling point of 2,2,3,3,4,4-hexafluoropentanedioic acid,silver is 289.6ºC at 760mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |