Pentane,1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)- structure
|
Common Name | Pentane,1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 355-91-9 | Molecular Weight | 302.10400 | |
| Density | 1.575g/cm3 | Boiling Point | 258.4ºC at 760mmHg | |
| Molecular Formula | C6H5F7N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110.1ºC | |
| Name | 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.575g/cm3 |
|---|---|
| Boiling Point | 258.4ºC at 760mmHg |
| Molecular Formula | C6H5F7N2O4 |
| Molecular Weight | 302.10400 |
| Flash Point | 110.1ºC |
| Exact Mass | 302.01400 |
| PSA | 91.64000 |
| LogP | 3.03530 |
| Index of Refraction | 1.365 |
| InChIKey | PAESHGHUQXDFGZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])CC(C[N+](=O)[O-])C(F)(F)C(F)(F)C(F)(F)F |
|
~%
Pentane,1,1,1,2... CAS#:355-91-9 |
| Literature: Cook et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 83,85 |
|
~%
Pentane,1,1,1,2... CAS#:355-91-9 |
| Literature: Cook et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 83,85 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1.3-Dinitro-2-heptafluorpropylpropan |
| 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-nitromethyl-pentane |
| 1,1,1,2,2,3,3-Heptafluor-5-nitro-4-nitromethyl-pentan |