Pentane,1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)
Pentane,1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl) structure
|
Common Name | Pentane,1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl) | ||
|---|---|---|---|---|
| CAS Number | 355-91-9 | Molecular Weight | 302.10400 | |
| Density | 1.575g/cm3 | Boiling Point | 258.4ºC at 760mmHg | |
| Molecular Formula | C6H5F7N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110.1ºC | |
Summary: 1,1,1,2,2,3,3-Heptafluoro-5-nitro-4-(nitromethyl)pentane (CAS: 355-91-9), molecular formula C6H5F7N2O4, molecular weight 302.10400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.575g/cm3 |
|---|---|
| Boiling Point | 258.4ºC at 760mmHg |
| Molecular Formula | C6H5F7N2O4 |
| Molecular Weight | 302.10400 |
| Flash Point | 110.1ºC |
| Exact Mass | 302.01400 |
| PSA | 91.64000 |
| LogP | 3.03530 |
| Index of Refraction | 1.365 |
| InChIKey | PAESHGHUQXDFGZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])CC(C[N+](=O)[O-])C(F)(F)C(F)(F)C(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Pentane,1,1,1,2... CAS#:355-91-9 |
| Literature: Cook et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 83,85 |
|
~%
Pentane,1,1,1,2... CAS#:355-91-9 |
| Literature: Cook et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 83,85 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1.3-Dinitro-2-heptafluorpropylpropan |
| 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-nitromethyl-pentane |
| 1,1,1,2,2,3,3-Heptafluor-5-nitro-4-nitromethyl-pentan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane? |
| A: The English name of 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane is 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane. |
| Q: What is the SMILES notation of 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane? |
| A: SMILES notation of 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane is O=[N+]([O-])CC(C[N+](=O)[O-])C(F)(F)C(F)(F)C(F)(F)F. |
| Q: What is the LogP of 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane? |
| A: LogP of 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane is 3.03530. |
| Q: What is the CAS number of 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane? |
| A: CAS number of 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane is 355-91-9. |
| Q: What are the upstream materials of 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane? |
| A: Related upstream materials(CAS) of 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane: 377-61-7;75-52-5. |
| Q: What is the polar surface area (PSA) of 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane? |
| A: Polar surface area (PSA) of 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane is 91.64000. |
| Q: What is the boiling point of 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane? |
| A: Boiling point of 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane is 258.4ºC at 760mmHg. |
| Q: What is the molecular formula of 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane? |
| A: Molecular formula of 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane is C6H5F7N2O4. |
| Q: What is the Chinese name of 355-91-9? |
| A: Chinese name of 355-91-9 is 355-91-9. |
| Q: What is the molecular weight of 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane? |
| A: Molecular weight of 1,1,1,2,2,3,3-heptafluoro-5-nitro-4-(nitromethyl)pentane is 302.10400. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |