(2,4-dibenzoyloxy-1-hydroxy-5-oxo-pentan-3-yl) benzoate structure
|
Common Name | (2,4-dibenzoyloxy-1-hydroxy-5-oxo-pentan-3-yl) benzoate | ||
|---|---|---|---|---|
| CAS Number | 35526-19-3 | Molecular Weight | 462.44800 | |
| Density | 1.306g/cm3 | Boiling Point | 648.7ºC at 760 mmHg | |
| Molecular Formula | C26H22O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3,4-dibenzoyloxy-1-hydroxy-5-oxopentan-2-yl) benzoate |
|---|
| Density | 1.306g/cm3 |
|---|---|
| Boiling Point | 648.7ºC at 760 mmHg |
| Molecular Formula | C26H22O8 |
| Molecular Weight | 462.44800 |
| Exact Mass | 462.13100 |
| PSA | 116.20000 |
| LogP | 2.85440 |
| Index of Refraction | 1.598 |
| InChIKey | KAXMCLJCFSUOAI-UHFFFAOYSA-N |
| SMILES | O=CC(OC(=O)c1ccccc1)C(OC(=O)c1ccccc1)C(CO)OC(=O)c1ccccc1 |
|
~%
(2,4-dibenzoylo... CAS#:35526-19-3 |
| Literature: Major; Cook Journal of the American Chemical Society, 1936 , vol. 58, p. 2333 |
|
~%
(2,4-dibenzoylo... CAS#:35526-19-3 |
| Literature: Major; Cook Journal of the American Chemical Society, 1936 , vol. 58, p. 2333 |
|
~%
(2,4-dibenzoylo... CAS#:35526-19-3 |
| Literature: Douglas; Honeyman Journal of the Chemical Society, 1955 , p. 3674,3680 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |