N-(propan-2-ylideneamino)-2-[(propan-2-ylideneamino)carbamoylmethoxy]acetamide structure
|
Common Name | N-(propan-2-ylideneamino)-2-[(propan-2-ylideneamino)carbamoylmethoxy]acetamide | ||
|---|---|---|---|---|
| CAS Number | 35532-26-4 | Molecular Weight | 242.27500 | |
| Density | 1.15g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H18N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-oxo-2-(2-propan-2-ylidenehydrazinyl)ethoxy]-N-(propan-2-ylideneamino)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.27500 |
| Exact Mass | 242.13800 |
| PSA | 92.15000 |
| LogP | 0.80880 |
| Index of Refraction | 1.513 |
| InChIKey | GYNOCEBHBLLZKV-UHFFFAOYSA-N |
| SMILES | CC(C)=NNC(=O)COCC(=O)NN=C(C)C |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N-(propan-2-ylideneamino)-2-[(propan-2-ylideneamino)carbamoylmethoxy]acetamide |