Butanedioic acid, 2,3-bis(benzoyloxy)-, (2R,3R)-(3S)-compd. with 3-piperidineMethanol (1:1) structure
|
Common Name | Butanedioic acid, 2,3-bis(benzoyloxy)-, (2R,3R)-(3S)-compd. with 3-piperidineMethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 355375-62-1 | Molecular Weight | 473.47200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H27NO9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2R,3R)-2,3-Bis(benzoyloxy)succinic acid-(3S)-3-piperidinylmeth anol (1:1) |
|---|
| Molecular Formula | C24H27NO9 |
|---|---|
| Molecular Weight | 473.47200 |
| Exact Mass | 473.16900 |
| PSA | 159.46000 |
| LogP | 1.91390 |
| InChIKey | KSEJKAHQFOLLEV-UHFFFAOYSA-N |
| SMILES | O=C(OC(C(=O)O)C(OC(=O)c1ccccc1)C(=O)O)c1ccccc1.OCC1CCCNC1 |