2-amino-1H-pyrrole-3,4-dicarboxamide
Modify Date: 2026-07-13 14:24:19
2-amino-1H-pyrrole-3,4-dicarboxamide structure
|
Common Name | 2-amino-1H-pyrrole-3,4-dicarboxamide | ||
|---|---|---|---|---|
| CAS Number | 355375-80-3 | Molecular Weight | 168.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H8N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-amino-1H-pyrrole-3,4-dicarboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H8N4O2 |
|---|---|
| Molecular Weight | 168.15 |
| InChIKey | SYTIQFBZZXXVEQ-UHFFFAOYSA-N |
| SMILES | NC(=O)c1c[nH]c(N)c1C(N)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-amino-1H-pyrrole-3,4-dicarboxamide? |
| A: Molecular weight of 2-amino-1H-pyrrole-3,4-dicarboxamide is 168.15. |
| Q: What is the Chinese name of 355375-80-3? |
| A: Chinese name of 355375-80-3 is 355375-80-3. |
| Q: What is the English name of 2-amino-1H-pyrrole-3,4-dicarboxamide? |
| A: The English name of 2-amino-1H-pyrrole-3,4-dicarboxamide is 2-amino-1H-pyrrole-3,4-dicarboxamide. |
| Q: What is the molecular formula of 2-amino-1H-pyrrole-3,4-dicarboxamide? |
| A: Molecular formula of 2-amino-1H-pyrrole-3,4-dicarboxamide is C6H8N4O2. |
| Q: What is the SMILES notation of 2-amino-1H-pyrrole-3,4-dicarboxamide? |
| A: SMILES notation of 2-amino-1H-pyrrole-3,4-dicarboxamide is NC(=O)c1c[nH]c(N)c1C(N)=O. |
| Q: What is the InChIKey of 2-amino-1H-pyrrole-3,4-dicarboxamide? |
| A: InChIKey of 2-amino-1H-pyrrole-3,4-dicarboxamide is SYTIQFBZZXXVEQ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-amino-1H-pyrrole-3,4-dicarboxamide? |
| A: CAS number of 2-amino-1H-pyrrole-3,4-dicarboxamide is 355375-80-3. |