(2,3-DIMETHOXY-BENZYL)-(4-FLUORO-BENZYL)-AMINE
Modify Date: 2025-09-26 18:17:53
(2,3-DIMETHOXY-BENZYL)-(4-FLUORO-BENZYL)-AMINE structure
|
Common Name | (2,3-DIMETHOXY-BENZYL)-(4-FLUORO-BENZYL)-AMINE | ||
|---|---|---|---|---|
| CAS Number | 355382-48-8 | Molecular Weight | 275.31800 | |
| Density | 1.128g/cm3 | Boiling Point | 366.5ºC at 760 mmHg | |
| Molecular Formula | C16H18FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.4ºC | |
| Name | N-[(2,3-dimethoxyphenyl)methyl]-1-(4-fluorophenyl)methanamine |
|---|
| Density | 1.128g/cm3 |
|---|---|
| Boiling Point | 366.5ºC at 760 mmHg |
| Molecular Formula | C16H18FNO2 |
| Molecular Weight | 275.31800 |
| Flash Point | 175.4ºC |
| Exact Mass | 275.13200 |
| PSA | 30.49000 |
| LogP | 3.52360 |
| Index of Refraction | 1.545 |
| InChIKey | WNGUYSAZLYGHJL-UHFFFAOYSA-N |
| SMILES | COc1cccc(CNCc2ccc(F)cc2)c1OC |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |