Benzoic acid, 4-nitro-,2-[(2-chlorophenyl)methylene]hydrazide structure
|
Common Name | Benzoic acid, 4-nitro-,2-[(2-chlorophenyl)methylene]hydrazide | ||
|---|---|---|---|---|
| CAS Number | 35559-06-9 | Molecular Weight | 303.70100 | |
| Density | 1.36g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H10ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(E)-(2-chlorophenyl)methylideneamino]-4-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Molecular Formula | C14H10ClN3O3 |
| Molecular Weight | 303.70100 |
| Exact Mass | 303.04100 |
| PSA | 87.28000 |
| LogP | 3.92620 |
| Index of Refraction | 1.63 |
| InChIKey | MDLUDOBZLZYCIK-CXUHLZMHSA-N |
| SMILES | O=C(NN=Cc1ccccc1Cl)c1ccc([N+](=O)[O-])cc1 |
|
~82%
Benzoic acid, 4... CAS#:35559-06-9 |
| Literature: Desai, Krunal G.; Desai Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2005 , vol. 44, # 10 p. 2097 - 2101 |
|
~%
Benzoic acid, 4... CAS#:35559-06-9 |
| Literature: Desai, Krunal G.; Desai Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2005 , vol. 44, # 10 p. 2097 - 2101 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N'-[(E)-(2-chlorophenyl)methylidene]-4-nitrobenzohydrazide |