1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride
1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride structure
|
Common Name | 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 35566-43-9 | Molecular Weight | 316.22300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H19Cl2NO2 |
|---|---|
| Molecular Weight | 316.22300 |
| Exact Mass | 315.07900 |
| PSA | 29.54000 |
| LogP | 3.38450 |
| InChIKey | WCQXFYMZHMCDET-UHFFFAOYSA-N |
| SMILES | Cl.O=C(C=Cc1ccccc1Cl)CCN1CCOCC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-(2-chlorophen... CAS#:35566-43-9 |
| Literature: Burckhalter; Johnson Journal of the American Chemical Society, 1951 , vol. 73, p. 4835 |
|
~%
1-(2-chlorophen... CAS#:35566-43-9 |
| Literature: Brown, George R.; Bamford, Andrea M.; Bowyer, Jonathan; James, Daniel S.; Rankine, Neil; Tang, Eric; Torr, Vanessa; Culbert, Eric J. Bioorganic and Medicinal Chemistry Letters, 2000 , vol. 10, # 6 p. 575 - 579 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride? |
| A: The English name of 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride is 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride. |
| Q: What is the molecular formula of 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride? |
| A: Molecular formula of 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride is C15H19Cl2NO2. |
| Q: What is the SMILES notation of 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride? |
| A: SMILES notation of 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride is Cl.O=C(C=Cc1ccccc1Cl)CCN1CCOCC1. |
| Q: What is the InChIKey of 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride? |
| A: InChIKey of 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride is WCQXFYMZHMCDET-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride? |
| A: Polar surface area (PSA) of 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride is 29.54000. |
| Q: What are the upstream materials of 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride? |
| A: Related upstream materials(CAS) of 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride: 50-00-0;10024-89-2;20766-37-4. |
| Q: What is the CAS number of 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride? |
| A: CAS number of 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride is 35566-43-9. |
| Q: What is the LogP of 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride? |
| A: LogP of 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride is 3.38450. |
| Q: What is the Chinese name of 35566-43-9? |
| A: Chinese name of 35566-43-9 is 35566-43-9. |
| Q: What is the molecular weight of 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride? |
| A: Molecular weight of 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride is 316.22300. |