1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride structure
|
Common Name | 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 35566-43-9 | Molecular Weight | 316.22300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-chlorophenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride |
|---|
| Molecular Formula | C15H19Cl2NO2 |
|---|---|
| Molecular Weight | 316.22300 |
| Exact Mass | 315.07900 |
| PSA | 29.54000 |
| LogP | 3.38450 |
| InChIKey | WCQXFYMZHMCDET-UHFFFAOYSA-N |
| SMILES | Cl.O=C(C=Cc1ccccc1Cl)CCN1CCOCC1 |
|
~%
1-(2-chlorophen... CAS#:35566-43-9 |
| Literature: Burckhalter; Johnson Journal of the American Chemical Society, 1951 , vol. 73, p. 4835 |
|
~%
1-(2-chlorophen... CAS#:35566-43-9 |
| Literature: Brown, George R.; Bamford, Andrea M.; Bowyer, Jonathan; James, Daniel S.; Rankine, Neil; Tang, Eric; Torr, Vanessa; Culbert, Eric J. Bioorganic and Medicinal Chemistry Letters, 2000 , vol. 10, # 6 p. 575 - 579 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |