1-(2-chlorophenyl)-5-piperidin-1-ylpent-1-en-3-one,hydrochloride structure
|
Common Name | 1-(2-chlorophenyl)-5-piperidin-1-ylpent-1-en-3-one,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 35566-54-2 | Molecular Weight | 314.25000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-chlorophenyl)-5-piperidin-1-ylpent-1-en-3-one,hydrochloride |
|---|
| Molecular Formula | C16H21Cl2NO |
|---|---|
| Molecular Weight | 314.25000 |
| Exact Mass | 313.10000 |
| PSA | 20.31000 |
| LogP | 4.53820 |
| InChIKey | AGNKWZYFEYOSSS-UHFFFAOYSA-N |
| SMILES | Cl.O=C(C=Cc1ccccc1Cl)CCN1CCCCC1 |
|
~%
1-(2-chlorophen... CAS#:35566-54-2 |
| Literature: Burckhalter; Johnson Journal of the American Chemical Society, 1951 , vol. 73, p. 4835 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |