2-Acetamido-5-nitrobenzoic acid structure
|
Common Name | 2-Acetamido-5-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 3558-18-7 | Molecular Weight | 224.170 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 501.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C9H8N2O5 | Melting Point | 215ºC | |
| MSDS | N/A | Flash Point | 257.2±28.7 °C | |
| Name | 2-acetamido-5-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 501.7±45.0 °C at 760 mmHg |
| Melting Point | 215ºC |
| Molecular Formula | C9H8N2O5 |
| Molecular Weight | 224.170 |
| Flash Point | 257.2±28.7 °C |
| Exact Mass | 224.043320 |
| PSA | 112.22000 |
| LogP | 2.66 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | QKTQWLSLKHKTST-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc([N+](=O)[O-])cc1C(=O)O |
| HS Code | 2924299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Nitro-2-acetamino-benzoesaeure |
| 2-Acetylamino-5-nitro-benzoesaeure |
| 2-Acetamido-5-nitrobenzoic acid |
| 2-acetamide-5-nitrobenzoic acid |
| 5-nitro-N-acetylanthranilic acid |
| N-Acetyl-5-nitro-anthranilsaeure |
| 2-(3-BROMOPHENYL)-4-(CHLOROMETHYL)-5-METHYLOXAZOLE |
| 2-Acetylamino-5-nitro-benzoic acid |
| Benzoic acid, 2-(acetylamino)-5-nitro- |