2-Amino-4-nitrobenzoic acid methyl ester structure
|
Common Name | 2-Amino-4-nitrobenzoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 3558-19-8 | Molecular Weight | 196.16000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 2-amino-4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8N2O4 |
|---|---|
| Molecular Weight | 196.16000 |
| Exact Mass | 196.04800 |
| PSA | 98.14000 |
| LogP | 2.06800 |
| InChIKey | VGURYVWLCVIMTF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc([N+](=O)[O-])cc1N |
| Storage condition | 2-8°C |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| methyl 2-amino-1-nitrobenzoate |
| 2-amino-4-nitro-benzoic acid,methyl ester |
| methyl 4-nitroanthranilate |
| methyl-4-nitro-2-amino-benzoate |