3,5-dimethyl-4-nitrobenzoyl chloride structure
|
Common Name | 3,5-dimethyl-4-nitrobenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 3558-73-4 | Molecular Weight | 213.61800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5-dimethyl-4-nitrobenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H8ClNO3 |
|---|---|
| Molecular Weight | 213.61800 |
| Exact Mass | 213.01900 |
| PSA | 62.89000 |
| LogP | 3.11380 |
| InChIKey | XDNZLOFKKSKKTJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)Cl)cc(C)c1[N+](=O)[O-] |
| HS Code | 2916399090 |
|---|
|
~82%
3,5-dimethyl-4-... CAS#:3558-73-4 |
| Literature: Goldstein, Stephen L.; McNelis, Edward Journal of Organic Chemistry, 1984 , vol. 49, # 9 p. 1613 - 1620 |
|
~%
3,5-dimethyl-4-... CAS#:3558-73-4 |
| Literature: Goldstein, Stephen L.; McNelis, Edward Journal of Organic Chemistry, 1984 , vol. 49, # 9 p. 1613 - 1620 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3,5-dimethyl-4-nitro-benzoyl chloride |
| 3,5-Dimethyl-4-nitro-benzoylchlorid |
| 4-Nitro-3,5-dimethyl-benzoylchlorid |
| Benzoyl chloride,3,5-dimethyl-4-nitro |
| 3,5-dimethyl-4-nitrobenzoic acid chloride |