N-[(2,5-dimethoxyphenyl)methyl]-1-(4-methoxyphenyl)methanamine
Modify Date: 2025-08-23 18:59:03
![N-[(2,5-dimethoxyphenyl)methyl]-1-(4-methoxyphenyl)methanamine Structure](https://image.chemsrc.com/caspic/296/355816-10-3.png)
N-[(2,5-dimethoxyphenyl)methyl]-1-(4-methoxyphenyl)methanamine structure
|
Common Name | N-[(2,5-dimethoxyphenyl)methyl]-1-(4-methoxyphenyl)methanamine | ||
|---|---|---|---|---|
| CAS Number | 355816-10-3 | Molecular Weight | 287.35400 | |
| Density | 1.089g/cm3 | Boiling Point | 415.7ºC at 760 mmHg | |
| Molecular Formula | C17H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.5ºC | |
| Name | N-[(2,5-dimethoxyphenyl)methyl]-1-(4-methoxyphenyl)methanamine |
|---|
| Density | 1.089g/cm3 |
|---|---|
| Boiling Point | 415.7ºC at 760 mmHg |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.35400 |
| Flash Point | 175.5ºC |
| Exact Mass | 287.15200 |
| PSA | 39.72000 |
| LogP | 3.39310 |
| Index of Refraction | 1.549 |
| InChIKey | DSTLUOCIHATZDD-UHFFFAOYSA-N |
| SMILES | COc1ccc(CNCc2cc(OC)ccc2OC)cc1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |