(2,4-DIMETHOXY-BENZYL)-(3-METHOXY-BENZYL)-AMINE structure
|
Common Name | (2,4-DIMETHOXY-BENZYL)-(3-METHOXY-BENZYL)-AMINE | ||
|---|---|---|---|---|
| CAS Number | 355816-85-2 | Molecular Weight | 287.35400 | |
| Density | 1.089g/cm3 | Boiling Point | 414.3ºC at 760 mmHg | |
| Molecular Formula | C17H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175ºC | |
| Name | N-[(2,4-dimethoxyphenyl)methyl]-1-(3-methoxyphenyl)methanamine |
|---|
| Density | 1.089g/cm3 |
|---|---|
| Boiling Point | 414.3ºC at 760 mmHg |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.35400 |
| Flash Point | 175ºC |
| Exact Mass | 287.15200 |
| PSA | 39.72000 |
| LogP | 3.39310 |
| Index of Refraction | 1.549 |
| InChIKey | PRKZXYUGWVSZGE-UHFFFAOYSA-N |
| SMILES | COc1cccc(CNCc2ccc(OC)cc2OC)c1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |