tert-butyl3-amino-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate structure
|
Common Name | tert-butyl3-amino-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 355819-02-2 | Molecular Weight | 249.309 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 420.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.2±28.7 °C | |
| Name | tert-butyl 3-amino-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 420.6±45.0 °C at 760 mmHg |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.309 |
| Flash Point | 208.2±28.7 °C |
| Exact Mass | 249.147720 |
| PSA | 68.45000 |
| LogP | 0.71 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | YHALGDJDGQKVHY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCc2ncc(N)cc2C1 |
| HS Code | 2933990090 |
|---|
|
~81%
tert-butyl3-ami... CAS#:355819-02-2 |
| Literature: Harling; Harrington; Thompson Synthetic Communications, 2001 , vol. 31, # 5 p. 787 - 797 |
|
~%
tert-butyl3-ami... CAS#:355819-02-2 |
| Literature: Harling; Harrington; Thompson Synthetic Communications, 2001 , vol. 31, # 5 p. 787 - 797 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,6-Naphthyridine-6(5H)-carboxylic acid, 3-amino-7,8-dihydro-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 3-amino-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate |
| tert-butyl3-amino-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate |