2-Methoxy-4-(trifluoromethoxy)-phenylboronic acid structure
|
Common Name | 2-Methoxy-4-(trifluoromethoxy)-phenylboronic acid | ||
|---|---|---|---|---|
| CAS Number | 355836-10-1 | Molecular Weight | 235.953 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 312.9±52.0 °C at 760 mmHg | |
| Molecular Formula | C8H8BF3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.1±30.7 °C | |
| Name | [2-methoxy-4-(trifluoromethoxy)phenyl]boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 312.9±52.0 °C at 760 mmHg |
| Molecular Formula | C8H8BF3O4 |
| Molecular Weight | 235.953 |
| Flash Point | 143.1±30.7 °C |
| Exact Mass | 236.046768 |
| PSA | 58.92000 |
| LogP | 2.34 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.465 |
| InChIKey | AJCQJELUJDPGEY-UHFFFAOYSA-N |
| SMILES | COc1cc(OC(F)(F)F)ccc1B(O)O |
| Storage condition | 2-8°C |
| HS Code | 2931900090 |
|---|
|
~%
2-Methoxy-4-(tr... CAS#:355836-10-1 |
| Literature: WO2005/23806 A2, ; Page/Page column 57-58 ; WO 2005/023806 A2 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2-Methoxy-4-(trifluoromethoxy)-phenylboronic acid |
| 2-methoxy-4-trifluoromethoxy-phenylboronic acid |
| 2-methoxy-4-trifluoromethoxybenzeneboronic acid |
| AM934 |
| 4-trifluoromethoxy-2-methoxy-phenylboronic acid |
| Boronic acid, B-[2-methoxy-4-(trifluoromethoxy)phenyl]- |
| [2-Methoxy-4-(trifluoromethoxy)phenyl]boronic acid |