2-Chloro-N-(2-methyl-5-nitrophenyl)acetamide
Modify Date: 2025-09-26 17:25:05
2-Chloro-N-(2-methyl-5-nitrophenyl)acetamide structure
|
Common Name | 2-Chloro-N-(2-methyl-5-nitrophenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 35588-36-4 | Molecular Weight | 228.63200 | |
| Density | 1.411g/cm3 | Boiling Point | 406ºC at 760mmHg | |
| Molecular Formula | C9H9ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.3ºC | |
| Name | 2-Chloro-N-(2-methyl-5-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.411g/cm3 |
|---|---|
| Boiling Point | 406ºC at 760mmHg |
| Molecular Formula | C9H9ClN2O3 |
| Molecular Weight | 228.63200 |
| Flash Point | 199.3ºC |
| Exact Mass | 228.03000 |
| PSA | 74.92000 |
| LogP | 2.67670 |
| Index of Refraction | 1.617 |
| InChIKey | YXLQFQSJHDHMLY-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)CCl |
| HS Code | 2924299090 |
|---|
|
~%
2-Chloro-N-(2-m... CAS#:35588-36-4 |
| Literature: Journal of the American Chemical Society, , vol. 52, p. 2019,2022 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| chloro-acetic acid-(2-methyl-5-nitro-anilide) |
| N-Chloracetyl-4-nitro-2-amino-toluol |
| Chlor-essigsaeure-(2-methyl-5-nitro-anilid) |