ethyl N-(2,2,3,3,3-pentafluoropropyl)carbamate
Modify Date: 2025-09-06 07:50:01
ethyl N-(2,2,3,3,3-pentafluoropropyl)carbamate structure
|
Common Name | ethyl N-(2,2,3,3,3-pentafluoropropyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 356-87-6 | Molecular Weight | 221.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H8F5NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl N-(2,2,3,3,3-pentafluoropropyl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H8F5NO2 |
|---|---|
| Molecular Weight | 221.13 |
| InChIKey | CTIPOLLNRSGIBR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NCC(F)(F)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 356-87-6? |
| A: Chinese name of 356-87-6 is 356-87-6. |
| Q: What is the SMILES notation of ethyl N-(2,2,3,3,3-pentafluoropropyl)carbamate? |
| A: SMILES notation of ethyl N-(2,2,3,3,3-pentafluoropropyl)carbamate is CCOC(=O)NCC(F)(F)C(F)(F)F. |
| Q: What is the English name of ethyl N-(2,2,3,3,3-pentafluoropropyl)carbamate? |
| A: The English name of ethyl N-(2,2,3,3,3-pentafluoropropyl)carbamate is ethyl N-(2,2,3,3,3-pentafluoropropyl)carbamate. |
| Q: What is the molecular weight of ethyl N-(2,2,3,3,3-pentafluoropropyl)carbamate? |
| A: Molecular weight of ethyl N-(2,2,3,3,3-pentafluoropropyl)carbamate is 221.13. |
| Q: What is the molecular formula of ethyl N-(2,2,3,3,3-pentafluoropropyl)carbamate? |
| A: Molecular formula of ethyl N-(2,2,3,3,3-pentafluoropropyl)carbamate is C6H8F5NO2. |
| Q: What is the CAS number of ethyl N-(2,2,3,3,3-pentafluoropropyl)carbamate? |
| A: CAS number of ethyl N-(2,2,3,3,3-pentafluoropropyl)carbamate is 356-87-6. |
| Q: What is the InChIKey of ethyl N-(2,2,3,3,3-pentafluoropropyl)carbamate? |
| A: InChIKey of ethyl N-(2,2,3,3,3-pentafluoropropyl)carbamate is CTIPOLLNRSGIBR-UHFFFAOYSA-N. |