2-(Isobutylamino)-2-methylpropyl benzoate hydrochloride (1:1) structure
|
Common Name | 2-(Isobutylamino)-2-methylpropyl benzoate hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 3562-15-0 | Molecular Weight | 285.81000 | |
| Density | N/A | Boiling Point | 340.1ºC at 760 mmHg | |
| Molecular Formula | C15H24ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.5ºC | |
| Name | 2-(Isobutylamino)-2-methylpropyl benzoate hydrochloride (1:1) |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 340.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C15H24ClNO2 |
| Molecular Weight | 285.81000 |
| Flash Point | 159.5ºC |
| Exact Mass | 285.15000 |
| PSA | 38.33000 |
| LogP | 4.06050 |
| InChIKey | HVBPUDDMBXSIGP-UHFFFAOYSA-N |
| SMILES | CC(C)CNC(C)(C)COC(=O)c1ccccc1.Cl |
| HS Code | 2922199090 |
|---|
|
~%
2-(Isobutylamin... CAS#:3562-15-0 |
| Literature: Reasenberg; Goldberg Journal of the American Chemical Society, 1945 , vol. 67, p. 933,936 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-benzoyloxy-2-dimethylamino-ethane,hydrochloride |
| 1-benzoyloxy-2-dimethylamino-ethane |
| 1-Benzoyloxy-2-isobutylamino-2-methyl-propan,Hydrochlorid |
| 1-Benzoyloxy-2-dimethylamino-aethan,Hydrochlorid |
| 1-benzoyloxy-2-isobutylamino-2-methyl-propane,hydrochloride |