(2R)-2-hydroxybutane-1,2,4-tricarboxylic acid structure
|
Common Name | (2R)-2-hydroxybutane-1,2,4-tricarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 3562-74-1 | Molecular Weight | 206.15000 | |
| Density | 1.642g/cm3 | Boiling Point | 411.3ºC at 760mmHg | |
| Molecular Formula | C7H10O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.7ºC | |
| Name | homocitric acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.642g/cm3 |
|---|---|
| Boiling Point | 411.3ºC at 760mmHg |
| Molecular Formula | C7H10O7 |
| Molecular Weight | 206.15000 |
| Flash Point | 216.7ºC |
| Exact Mass | 206.04300 |
| PSA | 132.13000 |
| Index of Refraction | 1.561 |
| InChIKey | XKJVEVRQMLKSMO-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(O)(CC(=O)O)C(=O)O |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-hydroxyl n-butyl 1,2,4-tricarboxylic acid |
| 1,2,4-Butanetricarboxylic acid,2-hydroxy |
| Homocitrate |
| Homocitric acid |
| 2-hydroxybutane-1,2,4-tricarboxylic acid |