3-(4-nitrophenyl)-6,7-diphenyl-[1,3]oxazolo[3,2-a][1,3,5]triazine-2,4-dione structure
|
Common Name | 3-(4-nitrophenyl)-6,7-diphenyl-[1,3]oxazolo[3,2-a][1,3,5]triazine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 35629-69-7 | Molecular Weight | 426.38100 | |
| Density | 1.45g/cm3 | Boiling Point | 611.5ºC at 760 mmHg | |
| Molecular Formula | C23H14N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.6ºC | |
| Name | 3-(4-nitrophenyl)-6,7-diphenyl-[1,3]oxazolo[3,2-a][1,3,5]triazine-2,4-dione |
|---|
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 611.5ºC at 760 mmHg |
| Molecular Formula | C23H14N4O5 |
| Molecular Weight | 426.38100 |
| Flash Point | 323.6ºC |
| Exact Mass | 426.09600 |
| PSA | 115.33000 |
| LogP | 4.20380 |
| Index of Refraction | 1.719 |
| InChIKey | VCELPVPFLVKNNW-UHFFFAOYSA-N |
| SMILES | O=c1nc2oc(-c3ccccc3)c(-c3ccccc3)n2c(=O)n1-c1ccc([N+](=O)[O-])cc1 |
|
~%
3-(4-nitropheny... CAS#:35629-69-7 |
| Literature: Crank; Foulis Journal of medicinal chemistry, 1971 , vol. 14, # 11 p. 1075 - 1077 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |