2-phenyl-2-prop-2-enylpent-4-enamide structure
|
Common Name | 2-phenyl-2-prop-2-enylpent-4-enamide | ||
|---|---|---|---|---|
| CAS Number | 3563-57-3 | Molecular Weight | 215.29100 | |
| Density | 1.01g/cm3 | Boiling Point | 364.6ºC at 760 mmHg | |
| Molecular Formula | C14H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.3ºC | |
| Name | 2-phenyl-2-prop-2-enylpent-4-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 364.6ºC at 760 mmHg |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.29100 |
| Flash Point | 174.3ºC |
| Exact Mass | 215.13100 |
| PSA | 44.08000 |
| LogP | 3.71160 |
| Index of Refraction | 1.533 |
| InChIKey | OLTOLZPJXXAQOK-UHFFFAOYSA-N |
| SMILES | C=CCC(CC=C)(C(N)=O)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
2-phenyl-2-prop... CAS#:3563-57-3 |
| Literature: Lumiere; Perrin Comptes Rendus Hebdomadaires des Seances de l'Academie des Sciences, 1926 , vol. 183, p. 618 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Pentenamide,2-allyl-2-phenyl |
| 2-allyl-2-phenyl-pent-4-enoic acid amide |
| Diallyl-phenyl-acetamid |
| 2-Allyl-2-phenyl-pent-4-ensaeure-amid |
| 2-Allyl-2-phenyl-4-pentenamide |
| CFT 1042 |
| Phenyldiallylacetamide |