4-Amino-1-(2-indol-3-ylethyl)piperidine structure
|
Common Name | 4-Amino-1-(2-indol-3-ylethyl)piperidine | ||
|---|---|---|---|---|
| CAS Number | 35633-77-3 | Molecular Weight | 243.34700 | |
| Density | 1.127g/cm3 | Boiling Point | 417.8ºC at 760 mmHg | |
| Molecular Formula | C15H21N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.5ºC | |
| Name | 1-[2-(1H-indol-3-yl)ethyl]piperidin-4-amine |
|---|
| Density | 1.127g/cm3 |
|---|---|
| Boiling Point | 417.8ºC at 760 mmHg |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.34700 |
| Flash Point | 206.5ºC |
| Exact Mass | 243.17400 |
| PSA | 45.05000 |
| LogP | 2.77170 |
| Index of Refraction | 1.624 |
| InChIKey | OYRXLTLEMXGPPF-UHFFFAOYSA-N |
| SMILES | NC1CCN(CCc2c[nH]c3ccccc23)CC1 |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |