3-hydroxy-4-[(4-methyl-2-nitrophenyl)azo]-N-(3-nitrophenyl)naphthalene-2-carboxamide structure
|
Common Name | 3-hydroxy-4-[(4-methyl-2-nitrophenyl)azo]-N-(3-nitrophenyl)naphthalene-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 3564-22-5 | Molecular Weight | 471.42200 | |
| Density | 1.45g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C24H17N5O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Deep red |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Molecular Formula | C24H17N5O6 |
| Molecular Weight | 471.42200 |
| Exact Mass | 471.11800 |
| PSA | 165.69000 |
| LogP | 7.45730 |
| Index of Refraction | 1.701 |
| InChIKey | MCSXGCZMEPXKIW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N=Nc2c(O)c(C(=O)Nc3cccc([N+](=O)[O-])c3)cc3ccccc23)c([N+](=O)[O-])c1 |
|
~%
3-hydroxy-4-[(4... CAS#:3564-22-5 |
| Literature: Rowe; Levin Journal of the Society of Dyers and Colourists, 1924 , vol. 40, p. 218,222 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| C.I.Pigment Red 18 |
| Einecs 222-643-8 |
| D and C Red No.38 |
| DEEPMAROON |
| 2-nitro-p-toluidin->3-hydroxy-3'-nitro-2-naphthanilid |