5-bromo-N-(tert-butyl)-2-furamide
Modify Date: 2025-11-25 14:22:09
5-bromo-N-(tert-butyl)-2-furamide structure
|
Common Name | 5-bromo-N-(tert-butyl)-2-furamide | ||
|---|---|---|---|---|
| CAS Number | 356562-19-1 | Molecular Weight | 246.10100 | |
| Density | 1.38g/cm3 | Boiling Point | 310ºC at 760 mmHg | |
| Molecular Formula | C9H12BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.3ºC | |
| Name | 5-bromo-N-tert-butylfuran-2-carboxamide |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 310ºC at 760 mmHg |
| Molecular Formula | C9H12BrNO2 |
| Molecular Weight | 246.10100 |
| Flash Point | 141.3ºC |
| Exact Mass | 245.00500 |
| PSA | 42.24000 |
| LogP | 2.96130 |
| Index of Refraction | 1.514 |
| InChIKey | WXIZGHGFAMCKTD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)c1ccc(Br)o1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |