(1-ethoxyethylideneamino) 2,5-dichlorobenzoate structure
|
Common Name | (1-ethoxyethylideneamino) 2,5-dichlorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 35657-44-4 | Molecular Weight | 276.11600 | |
| Density | 1.296g/cm3 | Boiling Point | 356.383ºC at 760 mmHg | |
| Molecular Formula | C11H11Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.335ºC | |
| Name | [(E)-1-ethoxyethylideneamino] 2,5-dichlorobenzoate |
|---|
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 356.383ºC at 760 mmHg |
| Molecular Formula | C11H11Cl2NO3 |
| Molecular Weight | 276.11600 |
| Flash Point | 169.335ºC |
| Exact Mass | 275.01200 |
| PSA | 47.89000 |
| LogP | 3.52010 |
| Index of Refraction | 1.534 |
| InChIKey | XHETYNBKRFZTFL-AUWJEWJLSA-N |
| SMILES | CCOC(C)=NOC(=O)c1cc(Cl)ccc1Cl |
|
~%
(1-ethoxyethyli... CAS#:35657-44-4 |
| Literature: Marmer,W.N.; Maerker,G. Journal of Organic Chemistry, 1972 , vol. 37, p. 3520 - 3523 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |