2-phenylsulfanylindene-1,3-dione structure
|
Common Name | 2-phenylsulfanylindene-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 35662-09-0 | Molecular Weight | 254.30400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-phenylsulfanylindene-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H10O2S |
|---|---|
| Molecular Weight | 254.30400 |
| Exact Mass | 254.04000 |
| PSA | 59.44000 |
| LogP | 3.22650 |
| InChIKey | JEIMRKCDSAFPFN-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)C1Sc1ccccc1 |
|
~82%
2-phenylsulfany... CAS#:35662-09-0 |
| Literature: Benati, Luisa; Calestani, Gianluca; Montevecchi, Pier Varlo; Spagnolo, Piero Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1995 , # 11 p. 1381 - 1386 |
| 2-phenylsulfanyl-2,3-dihydro-1H-indane-1,3-dione |
| 2-Phenylthio-1,3-indandion |