[2,2,2-trichloro-1,1-bis(4-chlorophenyl)ethyl] acetate structure
|
Common Name | [2,2,2-trichloro-1,1-bis(4-chlorophenyl)ethyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 3567-16-6 | Molecular Weight | 412.52200 | |
| Density | 1.469g/cm3 | Boiling Point | 498.6ºC at 760mmHg | |
| Molecular Formula | C16H11Cl5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.9ºC | |
| Name | [2,2,2-trichloro-1,1-bis(4-chlorophenyl)ethyl] acetate |
|---|
| Density | 1.469g/cm3 |
|---|---|
| Boiling Point | 498.6ºC at 760mmHg |
| Molecular Formula | C16H11Cl5O2 |
| Molecular Weight | 412.52200 |
| Flash Point | 185.9ºC |
| Exact Mass | 409.92000 |
| PSA | 26.30000 |
| LogP | 6.17030 |
| Index of Refraction | 1.592 |
| InChIKey | FQRHPPJYVGGBMR-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)C(Cl)(Cl)Cl |
| HS Code | 2915390090 |
|---|
|
~%
[2,2,2-trichlor... CAS#:3567-16-6 |
| Literature: Bergmann; Kaluszyner Journal of Organic Chemistry, 1958 , vol. 23, p. 1306 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |