N,N-Dimethylcarbamic acid 2,6-dimethyl-4-pyridyl ester structure
|
Common Name | N,N-Dimethylcarbamic acid 2,6-dimethyl-4-pyridyl ester | ||
|---|---|---|---|---|
| CAS Number | 3567-51-9 | Molecular Weight | 194.23000 | |
| Density | 1.099g/cm3 | Boiling Point | 282.5ºC at 760 mmHg | |
| Molecular Formula | C10H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.7ºC | |
| Name | (2,6-dimethylpyridin-4-yl) N,N-dimethylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.099g/cm3 |
|---|---|
| Boiling Point | 282.5ºC at 760 mmHg |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23000 |
| Flash Point | 124.7ºC |
| Exact Mass | 194.10600 |
| PSA | 42.43000 |
| LogP | 1.75880 |
| Index of Refraction | 1.52 |
| InChIKey | ZRGHQYBDXCTONF-UHFFFAOYSA-N |
| SMILES | Cc1cc(OC(=O)N(C)C)cc(C)n1 |
| HS Code | 2933399090 |
|---|
|
~%
N,N-Dimethylcar... CAS#:3567-51-9 |
| Literature: Hoechst Aktiengesellschaft Patent: US4168311 A1, 1979 ; |
|
~%
N,N-Dimethylcar... CAS#:3567-51-9 |
| Literature: Geigy A.G. Patent: DE844741 , 1950 ; DRP/DRBP Org.Chem. Full Text Show Details Geigy A.G. Patent: US2681879 , 1950 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-Dimethyl-4-pyridinyl dimethylcarbamate |
| 2,6-dimethyl-4-dimethylaminocarbonyloxy-pyridine |
| 2,6-dimethyl-4-pyridyl N-dimethyl carbamate |
| CARBAMIC ACID,DIMETHYL-,2,6-DIMETHYL-4-PYRIDINYL ESTER |
| Dimethylcarbamic acid,2,6-dimethyl-4-pyridinyl ester |
| 2,6-Dimethyl-4-pyridyl dimethylcarbamate |