3-methyl-1-(2,4,6-trimethoxy-3,5-dimethyl-phenyl)butan-1-one structure
|
Common Name | 3-methyl-1-(2,4,6-trimethoxy-3,5-dimethyl-phenyl)butan-1-one | ||
|---|---|---|---|---|
| CAS Number | 3567-96-2 | Molecular Weight | 280.35900 | |
| Density | 1.017g/cm3 | Boiling Point | 402.1ºC at 760 mmHg | |
| Molecular Formula | C16H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.5ºC | |
| Name | 3-methyl-1-(2,4,6-trimethoxy-3,5-dimethylphenyl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.017g/cm3 |
|---|---|
| Boiling Point | 402.1ºC at 760 mmHg |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.35900 |
| Flash Point | 175.5ºC |
| Exact Mass | 280.16700 |
| PSA | 44.76000 |
| LogP | 3.55800 |
| Index of Refraction | 1.491 |
| InChIKey | PYUCCSKQLHUKCA-UHFFFAOYSA-N |
| SMILES | COc1c(C)c(OC)c(C(=O)CC(C)C)c(OC)c1C |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| torquatone |