Amidapsone structure
|
Common Name | Amidapsone | ||
|---|---|---|---|---|
| CAS Number | 3569-77-5 | Molecular Weight | 291.32600 | |
| Density | 1.454g/cm3 | Boiling Point | 536.4ºC at 760mmHg | |
| Molecular Formula | C13H13N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.2ºC | |
| Name | [4-(4-aminophenyl)sulfonylphenyl]urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.454g/cm3 |
|---|---|
| Boiling Point | 536.4ºC at 760mmHg |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.32600 |
| Flash Point | 278.2ºC |
| Exact Mass | 291.06800 |
| PSA | 123.66000 |
| LogP | 4.02750 |
| Index of Refraction | 1.682 |
| InChIKey | UPWPBIUUSLIWAI-UHFFFAOYSA-N |
| SMILES | NC(=O)Nc1ccc(S(=O)(=O)c2ccc(N)cc2)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
Amidapsone CAS#:3569-77-5 |
| Literature: Schering Corp. Patent: US2328548 , 1939 ; |
|
~%
Amidapsone CAS#:3569-77-5 |
| Literature: Schering Corp. Patent: US2328548 , 1939 ; |
|
~%
Amidapsone CAS#:3569-77-5 |
| Literature: Schering Corp. Patent: US2328548 , 1939 ; |
|
~%
Amidapsone CAS#:3569-77-5 |
| Literature: Schering Corp. Patent: US2328548 , 1939 ; |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| p-Amino-p'-ureidodiphenyl sulfone |
| Sulfone,p-aminophenyl p-ureidophenyl |
| 4-Amino-4'-ureidodiphenyl sulfone |
| [4-(4-Amino-phenylsulfon)-phenyl]-harnstoff |
| 4-(N-Sulfanilyl)phenylurea |
| Sulfacid |
| (4-Sulfanilylphenyl)urea |
| Sulfacide |
| 4-Sulfanilylphenylharnstoff |
| Amidapsone |